C14H18FNOS — CID 114728983
2-butan-2-ylsulfanyl-1-(5-fluoro-1-benzofuran-2-yl)ethanamine (PubChem CID 114728983) has the molecular formula C14H18FNOS and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-butan-2-ylsulfanyl-1-(5-fluoro-1-benzofuran-2-yl)ethanamine.
| Compound Name | 2-butan-2-ylsulfanyl-1-(5-fluoro-1-benzofuran-2-yl)ethanamine |
|---|---|
| PubChem CID | 114728983 |
| Molecular Formula | C14H18FNOS |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-butan-2-ylsulfanyl-1-(5-fluoro-1-benzofuran-2-yl)ethanamine |
| SMILES | CCC(C)SCC(N)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C14H18FNOS/c1-3-9(2)18-8-12(16)14-7-10-6-11(15)4-5-13(10)17-14/h4-7,9,12H,3,8,16H2,1-2H3 |
| InChIKey | LZOLWYSUQVLTLT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |