C16H15FN2O — CID 114730648
1-(5-fluoro-1-benzofuran-2-yl)-N-methyl-1-(3-methyl-4-pyridinyl)methanamine (PubChem CID 114730648) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is 1-(5-fluoro-1-benzofuran-2-yl)-N-methyl-1-(3-methyl-4-pyridinyl)methanamine.
| Compound Name | 1-(5-fluoro-1-benzofuran-2-yl)-N-methyl-1-(3-methyl-4-pyridinyl)methanamine |
|---|---|
| PubChem CID | 114730648 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-(5-fluoro-1-benzofuran-2-yl)-N-methyl-1-(3-methyl-4-pyridinyl)methanamine |
| SMILES | CNC(c1cc2cc(F)ccc2o1)c1ccncc1C |
| InChI | InChI=1S/C16H15FN2O/c1-10-9-19-6-5-13(10)16(18-2)15-8-11-7-12(17)3-4-14(11)20-15/h3-9,16,18H,1-2H3 |
| InChIKey | UHZLYIJNRODSAD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |