C19H26O5 — CID 11473099
dimethyl (4aS,5R,6S,6aR)-9-oxo-1,2,3,4,4a,5,6,6a,7,8,10,11-dodecahydrocyclohepta[c]naphthalene-5,6-dicarboxylate (PubChem CID 11473099) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is dimethyl (4aS,5R,6S,6aR)-9-oxo-1,2,3,4,4a,5,6,6a,7,8,10,11-dodecahydrocyclohepta[c]naphthalene-5,6-dicarboxylate.
| Compound Name | dimethyl (4aS,5R,6S,6aR)-9-oxo-1,2,3,4,4a,5,6,6a,7,8,10,11-dodecahydrocyclohepta[c]naphthalene-5,6-dicarboxylate |
|---|---|
| PubChem CID | 11473099 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | dimethyl (4aS,5R,6S,6aR)-9-oxo-1,2,3,4,4a,5,6,6a,7,8,10,11-dodecahydrocyclohepta[c]naphthalene-5,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@@H]2CCCCC2=C2CCC(=O)CC[C@@H]21 |
| InChI | InChI=1S/C19H26O5/c1-23-18(21)16-14-6-4-3-5-12(14)13-9-7-11(20)8-10-15(13)17(16)19(22)24-2/h14-17H,3-10H2,1-2H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | KVKJYUJULUYKGS-TWMKSMIVSA-N |
| XLogP | 2.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|