C18H16FNO — CID 114732131
N-[[3-(1-benzofuran-2-yl)-4-fluorophenyl]methyl]cyclopropanamine (PubChem CID 114732131) has the molecular formula C18H16FNO and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[[3-(1-benzofuran-2-yl)-4-fluorophenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(1-benzofuran-2-yl)-4-fluorophenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114732131 |
| Molecular Formula | C18H16FNO |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[[3-(1-benzofuran-2-yl)-4-fluorophenyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(CNC2CC2)cc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H16FNO/c19-16-8-5-12(11-20-14-6-7-14)9-15(16)18-10-13-3-1-2-4-17(13)21-18/h1-5,8-10,14,20H,6-7,11H2 |
| InChIKey | VSFIOFRARMTERE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |