C18H16FNS — CID 81128764
N-[[3-(1-benzothiophen-7-yl)-4-fluorophenyl]methyl]cyclopropanamine (PubChem CID 81128764) has the molecular formula C18H16FNS and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[[3-(1-benzothiophen-7-yl)-4-fluorophenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(1-benzothiophen-7-yl)-4-fluorophenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81128764 |
| Molecular Formula | C18H16FNS |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[[3-(1-benzothiophen-7-yl)-4-fluorophenyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(CNC2CC2)cc1-c1cccc2ccsc12 |
| InChI | InChI=1S/C18H16FNS/c19-17-7-4-12(11-20-14-5-6-14)10-16(17)15-3-1-2-13-8-9-21-18(13)15/h1-4,7-10,14,20H,5-6,11H2 |
| InChIKey | DKGZGSLCSGQQQL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |