C17H20FNOS — CID 62358495
2-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]cyclohexan-1-ol (PubChem CID 62358495) has the molecular formula C17H20FNOS and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]cyclohexan-1-ol.
| Compound Name | 2-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 62358495 |
| Molecular Formula | C17H20FNOS |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]cyclohexan-1-ol |
| SMILES | OC1CCCCC1NCc1ccc(F)c(-c2cccs2)c1 |
| InChI | InChI=1S/C17H20FNOS/c18-14-8-7-12(10-13(14)17-6-3-9-21-17)11-19-15-4-1-2-5-16(15)20/h3,6-10,15-16,19-20H,1-2,4-5,11H2 |
| InChIKey | FRIAGLCZYQLCFT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |