C17H20FNOS — CID 103887823
N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-2-methyloxan-4-amine (PubChem CID 103887823) has the molecular formula C17H20FNOS and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-2-methyloxan-4-amine.
| Compound Name | N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-2-methyloxan-4-amine |
|---|---|
| PubChem CID | 103887823 |
| Molecular Formula | C17H20FNOS |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-2-methyloxan-4-amine |
| SMILES | CC1CC(NCc2ccc(F)c(-c3cccs3)c2)CCO1 |
| InChI | InChI=1S/C17H20FNOS/c1-12-9-14(6-7-20-12)19-11-13-4-5-16(18)15(10-13)17-3-2-8-21-17/h2-5,8,10,12,14,19H,6-7,9,11H2,1H3 |
| InChIKey | AQPLTXOHROWINH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |