C17H21FN2S — CID 61103811
N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-1-(1-methylpyrrolidin-3-yl)methanamine (PubChem CID 61103811) has the molecular formula C17H21FN2S and a molecular weight of 304.43 g/mol. Its IUPAC name is N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-1-(1-methylpyrrolidin-3-yl)methanamine.
| Compound Name | N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-1-(1-methylpyrrolidin-3-yl)methanamine |
|---|---|
| PubChem CID | 61103811 |
| Molecular Formula | C17H21FN2S |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-1-(1-methylpyrrolidin-3-yl)methanamine |
| SMILES | CN1CCC(CNCc2ccc(F)c(-c3cccs3)c2)C1 |
| InChI | InChI=1S/C17H21FN2S/c1-20-7-6-14(12-20)11-19-10-13-4-5-16(18)15(9-13)17-3-2-8-21-17/h2-5,8-9,14,19H,6-7,10-12H2,1H3 |
| InChIKey | RRNMTBCXYXTIQM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |