C16H19FN2OS — CID 61104199
3-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]-N,N-dimethylpropanamide (PubChem CID 61104199) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]-N,N-dimethylpropanamide.
| Compound Name | 3-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 61104199 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNCc1ccc(F)c(-c2cccs2)c1 |
| InChI | InChI=1S/C16H19FN2OS/c1-19(2)16(20)7-8-18-11-12-5-6-14(17)13(10-12)15-4-3-9-21-15/h3-6,9-10,18H,7-8,11H2,1-2H3 |
| InChIKey | HIAXSZDZSWZBQH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|