C16H18FNO2S — CID 61103428
methyl 2-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]-2-methylpropanoate (PubChem CID 61103428) has the molecular formula C16H18FNO2S and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl 2-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]-2-methylpropanoate.
| Compound Name | methyl 2-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 61103428 |
| Molecular Formula | C16H18FNO2S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl 2-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NCc1ccc(F)c(-c2cccs2)c1 |
| InChI | InChI=1S/C16H18FNO2S/c1-16(2,15(19)20-3)18-10-11-6-7-13(17)12(9-11)14-5-4-8-21-14/h4-9,18H,10H2,1-3H3 |
| InChIKey | HBUSMFONKHRCCW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |