C18H20FNS — CID 106169126
2-(cyclopenten-1-yl)-N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]ethanamine (PubChem CID 106169126) has the molecular formula C18H20FNS and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]ethanamine.
| Compound Name | 2-(cyclopenten-1-yl)-N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106169126 |
| Molecular Formula | C18H20FNS |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(cyclopenten-1-yl)-N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]ethanamine |
| SMILES | Fc1ccc(CNCCC2=CCCC2)cc1-c1cccs1 |
| InChI | InChI=1S/C18H20FNS/c19-17-8-7-15(12-16(17)18-6-3-11-21-18)13-20-10-9-14-4-1-2-5-14/h3-4,6-8,11-12,20H,1-2,5,9-10,13H2 |
| InChIKey | IPXHJNCWCQCUKO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|