C17H17F2N — CID 115502872
N-[[3-fluoro-4-(3-fluoro-2-methylphenyl)phenyl]methyl]cyclopropanamine (PubChem CID 115502872) has the molecular formula C17H17F2N and a molecular weight of 273.33 g/mol. Its IUPAC name is N-[[3-fluoro-4-(3-fluoro-2-methylphenyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-fluoro-4-(3-fluoro-2-methylphenyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 115502872 |
| Molecular Formula | C17H17F2N |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[[3-fluoro-4-(3-fluoro-2-methylphenyl)phenyl]methyl]cyclopropanamine |
| SMILES | Cc1c(F)cccc1-c1ccc(CNC2CC2)cc1F |
| InChI | InChI=1S/C17H17F2N/c1-11-14(3-2-4-16(11)18)15-8-5-12(9-17(15)19)10-20-13-6-7-13/h2-5,8-9,13,20H,6-7,10H2,1H3 |
| InChIKey | SAPYCMJBQLFSKK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |