C18H18N2O — CID 114732262
N-[[5-(5-methyl-1-benzofuran-2-yl)-3-pyridinyl]methyl]cyclopropanamine (PubChem CID 114732262) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[[5-(5-methyl-1-benzofuran-2-yl)-3-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(5-methyl-1-benzofuran-2-yl)-3-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114732262 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[[5-(5-methyl-1-benzofuran-2-yl)-3-pyridinyl]methyl]cyclopropanamine |
| SMILES | Cc1ccc2oc(-c3cncc(CNC4CC4)c3)cc2c1 |
| InChI | InChI=1S/C18H18N2O/c1-12-2-5-17-14(6-12)8-18(21-17)15-7-13(9-19-11-15)10-20-16-3-4-16/h2,5-9,11,16,20H,3-4,10H2,1H3 |
| InChIKey | QJJVOLKLXPRVSU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |