C15H13BrF2N2 — CID 106943333
N-[[5-(3-bromo-2,6-difluorophenyl)-3-pyridinyl]methyl]cyclopropanamine (PubChem CID 106943333) has the molecular formula C15H13BrF2N2 and a molecular weight of 339.18 g/mol. Its IUPAC name is N-[[5-(3-bromo-2,6-difluorophenyl)-3-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(3-bromo-2,6-difluorophenyl)-3-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106943333 |
| Molecular Formula | C15H13BrF2N2 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-[[5-(3-bromo-2,6-difluorophenyl)-3-pyridinyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(Br)c(F)c1-c1cncc(CNC2CC2)c1 |
| InChI | InChI=1S/C15H13BrF2N2/c16-12-3-4-13(17)14(15(12)18)10-5-9(6-19-8-10)7-20-11-1-2-11/h3-6,8,11,20H,1-2,7H2 |
| InChIKey | AUEKOMJOLQQFOJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|