C13H13NO — CID 114732983
3-(7-methyl-1-benzofuran-2-yl)-2,5-dihydro-1H-pyrrole (PubChem CID 114732983) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-(7-methyl-1-benzofuran-2-yl)-2,5-dihydro-1H-pyrrole.
| Compound Name | 3-(7-methyl-1-benzofuran-2-yl)-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 114732983 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-(7-methyl-1-benzofuran-2-yl)-2,5-dihydro-1H-pyrrole |
| SMILES | Cc1cccc2cc(C3=CCNC3)oc12 |
| InChI | InChI=1S/C13H13NO/c1-9-3-2-4-10-7-12(15-13(9)10)11-5-6-14-8-11/h2-5,7,14H,6,8H2,1H3 |
| InChIKey | NSVIEPNBHXHKTO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |