C13H8Cl2N2O — CID 114734145
3,6-dichloro-4-(7-methyl-1-benzofuran-2-yl)pyridazine (PubChem CID 114734145) has the molecular formula C13H8Cl2N2O and a molecular weight of 279.13 g/mol. Its IUPAC name is 3,6-dichloro-4-(7-methyl-1-benzofuran-2-yl)pyridazine.
| Compound Name | 3,6-dichloro-4-(7-methyl-1-benzofuran-2-yl)pyridazine |
|---|---|
| PubChem CID | 114734145 |
| Molecular Formula | C13H8Cl2N2O |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 3,6-dichloro-4-(7-methyl-1-benzofuran-2-yl)pyridazine |
| SMILES | Cc1cccc2cc(-c3cc(Cl)nnc3Cl)oc12 |
| InChI | InChI=1S/C13H8Cl2N2O/c1-7-3-2-4-8-5-10(18-12(7)8)9-6-11(14)16-17-13(9)15/h2-6H,1H3 |
| InChIKey | CRWGLMLGRYNEAF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |