C20H23N3O3 — CID 11473659
tert-butyl 3-[3-(dimethylamino)prop-1-ynyl]-5-(3-hydroxyprop-1-ynyl)indazole-1-carboxylate (PubChem CID 11473659) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is tert-butyl 3-[3-(dimethylamino)prop-1-ynyl]-5-(3-hydroxyprop-1-ynyl)indazole-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(dimethylamino)prop-1-ynyl]-5-(3-hydroxyprop-1-ynyl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 11473659 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | tert-butyl 3-[3-(dimethylamino)prop-1-ynyl]-5-(3-hydroxyprop-1-ynyl)indazole-1-carboxylate |
| SMILES | CN(C)CC#Cc1nn(C(=O)OC(C)(C)C)c2ccc(C#CCO)cc12 |
| InChI | InChI=1S/C20H23N3O3/c1-20(2,3)26-19(25)23-18-11-10-15(8-7-13-24)14-16(18)17(21-23)9-6-12-22(4)5/h10-11,14,24H,12-13H2,1-5H3 |
| InChIKey | JMXLUWMDSKWVIU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|