C18H15NO2 — CID 114737357
1-benzofuran-2-yl(1,2,3,4-tetrahydroquinolin-5-yl)methanone (PubChem CID 114737357) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-benzofuran-2-yl(1,2,3,4-tetrahydroquinolin-5-yl)methanone.
| Compound Name | 1-benzofuran-2-yl(1,2,3,4-tetrahydroquinolin-5-yl)methanone |
|---|---|
| PubChem CID | 114737357 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-benzofuran-2-yl(1,2,3,4-tetrahydroquinolin-5-yl)methanone |
| SMILES | O=C(c1cc2ccccc2o1)c1cccc2c1CCCN2 |
| InChI | InChI=1S/C18H15NO2/c20-18(17-11-12-5-1-2-9-16(12)21-17)14-6-3-8-15-13(14)7-4-10-19-15/h1-3,5-6,8-9,11,19H,4,7,10H2 |
| InChIKey | SKDGFRHDMOBJQO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |