About 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline
6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline (PubChem CID 114740932) has the molecular formula C16H15N5
and a molecular weight of 277.33 g/mol. Its IUPAC name is 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline.
Molecular Properties
| Compound Name | 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline |
| PubChem CID | 114740932 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline |
| SMILES | CCc1nc(-c2ccc3nccnc3c2)nc2c1CNC2 |
| InChI | InChI=1S/C16H15N5/c1-2-12-11-8-17-9-15(11)21-16(20-12)10-3-4-13-14(7-10)19-6-5-18-13/h3-7,17H,2,8-9H2,1H3 |
| InChIKey | NPAYIILGFHDRLY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline?
The IUPAC name of 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline (CID 114740932) is 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline.
What is the SMILES notation for 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline?
The canonical SMILES for 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline is CCc1nc(-c2ccc3nccnc3c2)nc2c1CNC2.
What is the InChIKey of 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline?
The InChIKey is NPAYIILGFHDRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5/c1-2-12-11-8-17-9-15(11)21-16(20-12)10-3-4-13-14(7-10)19-6-5-18-13/h3-7,17H,2,8-9H2,1H3.
What are the key properties of 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline?
6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline has a molecular weight of 277.33 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-ethyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-yl)quinoxaline is sourced from PubChem (CID 114740932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).