C17H22O7S — CID 11474172
methyl (1R,3S,5R)-3-acetyloxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate (PubChem CID 11474172) has the molecular formula C17H22O7S and a molecular weight of 370.42 g/mol. Its IUPAC name is methyl (1R,3S,5R)-3-acetyloxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate.
| Compound Name | methyl (1R,3S,5R)-3-acetyloxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11474172 |
| Molecular Formula | C17H22O7S |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl (1R,3S,5R)-3-acetyloxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(C)=O)C[C@H](OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C17H22O7S/c1-11-4-6-16(7-5-11)25(20,21)24-15-9-13(17(19)22-3)8-14(10-15)23-12(2)18/h4-7,13-15H,8-10H2,1-3H3/t13-,14+,15-/m1/s1 |
| InChIKey | IFCCNIGKFKRSOM-QLFBSQMISA-N |
| XLogP | 1.97 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|