C19H34O5Si — CID 11474184
(3aS,5R,6R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-5,6a-diethyl-6-hydroxy-3,6-dihydrofuro[3,2-b]furan-2-one (PubChem CID 11474184) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is (3aS,5R,6R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-5,6a-diethyl-6-hydroxy-3,6-dihydrofuro[3,2-b]furan-2-one.
| Compound Name | (3aS,5R,6R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-5,6a-diethyl-6-hydroxy-3,6-dihydrofuro[3,2-b]furan-2-one |
|---|---|
| PubChem CID | 11474184 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (3aS,5R,6R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-5,6a-diethyl-6-hydroxy-3,6-dihydrofuro[3,2-b]furan-2-one |
| SMILES | C=C[C@@]1(CC)O[C@]2(CO[Si](C)(C)C(C)(C)C)CC(=O)O[C@]2(CC)[C@@H]1O |
| InChI | InChI=1S/C19H34O5Si/c1-9-17(10-2)15(21)19(11-3)18(24-17,12-14(20)23-19)13-22-25(7,8)16(4,5)6/h9,15,21H,1,10-13H2,2-8H3/t15-,17+,18+,19-/m1/s1 |
| InChIKey | QLHXNZMQAYOYQO-XGXHKWSGSA-N |
| XLogP | 3.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|