C31H64O7Si2 — CID 54578587
[(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoate (PubChem CID 54578587) has the molecular formula C31H64O7Si2 and a molecular weight of 605.02 g/mol. Its IUPAC name is [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoate.
| Compound Name | [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoate |
|---|---|
| PubChem CID | 54578587 |
| Molecular Formula | C31H64O7Si2 |
| Molecular Weight | 605.02 g/mol |
| Exact Mass | 604.42 |
| IUPAC Name | [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoate |
| SMILES | C=C[C@](C)(O)[C@@H](CC)OC(=O)[C@H](C)[C@H](C[C@@H](O[Si](CC)(CC)CC)[C@@](C)(CCCO)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O7Si2/c1-15-26(30(10,34)16-2)36-28(33)24(6)25(37-39(13,14)29(7,8)9)23-27(31(11,35-12)21-20-22-32)38-40(17-3,18-4)19-5/h16,24-27,32,34H,2,15,17-23H2,1,3-14H3/t24-,25+,26-,27-,30+,31-/m1/s1 |
| InChIKey | GZQSVTDIPVXHCC-WOCKNQBSSA-N |
| XLogP | 7.23 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.02 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|