C14H19NO2 — CID 114743211
3-(3,4-dihydro-2H-chromen-8-yl)-1-methylpyrrolidin-3-ol (PubChem CID 114743211) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-8-yl)-1-methylpyrrolidin-3-ol.
| Compound Name | 3-(3,4-dihydro-2H-chromen-8-yl)-1-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 114743211 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-8-yl)-1-methylpyrrolidin-3-ol |
| SMILES | CN1CCC(O)(c2cccc3c2OCCC3)C1 |
| InChI | InChI=1S/C14H19NO2/c1-15-8-7-14(16,10-15)12-6-2-4-11-5-3-9-17-13(11)12/h2,4,6,16H,3,5,7-10H2,1H3 |
| InChIKey | CGXZFKUULWBXLI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |