C15H20O3 — CID 114743729
1-(2,3-dihydro-1-benzofuran-7-yl)-4-methoxycyclohexan-1-ol (PubChem CID 114743729) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-7-yl)-4-methoxycyclohexan-1-ol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-7-yl)-4-methoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 114743729 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-7-yl)-4-methoxycyclohexan-1-ol |
| SMILES | COC1CCC(O)(c2cccc3c2OCC3)CC1 |
| InChI | InChI=1S/C15H20O3/c1-17-12-5-8-15(16,9-6-12)13-4-2-3-11-7-10-18-14(11)13/h2-4,12,16H,5-10H2,1H3 |
| InChIKey | YXZMWKSQCWLRQI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |