C13H14N2OS — CID 114745898
3,4-dihydro-2H-chromen-8-yl(1,3-thiazol-5-yl)methanamine (PubChem CID 114745898) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-8-yl(1,3-thiazol-5-yl)methanamine.
| Compound Name | 3,4-dihydro-2H-chromen-8-yl(1,3-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 114745898 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3,4-dihydro-2H-chromen-8-yl(1,3-thiazol-5-yl)methanamine |
| SMILES | NC(c1cncs1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C13H14N2OS/c14-12(11-7-15-8-17-11)10-5-1-3-9-4-2-6-16-13(9)10/h1,3,5,7-8,12H,2,4,6,14H2 |
| InChIKey | IUKGYRWZKYBCGJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |