C15H19BrO — CID 114746748
7-(2-bromocycloheptyl)-2,3-dihydro-1-benzofuran (PubChem CID 114746748) has the molecular formula C15H19BrO and a molecular weight of 295.22 g/mol. Its IUPAC name is 7-(2-bromocycloheptyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 7-(2-bromocycloheptyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 114746748 |
| Molecular Formula | C15H19BrO |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 7-(2-bromocycloheptyl)-2,3-dihydro-1-benzofuran |
| SMILES | BrC1CCCCCC1c1cccc2c1OCC2 |
| InChI | InChI=1S/C15H19BrO/c16-14-8-3-1-2-6-12(14)13-7-4-5-11-9-10-17-15(11)13/h4-5,7,12,14H,1-3,6,8-10H2 |
| InChIKey | OIPGCEUXPIMDMA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|