C11H19NO2 — CID 114750967
N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-methylbut-2-enamide (PubChem CID 114750967) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-methylbut-2-enamide.
| Compound Name | N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 114750967 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)NCC1(CCO)CC1 |
| InChI | InChI=1S/C11H19NO2/c1-9(2)7-10(14)12-8-11(3-4-11)5-6-13/h7,13H,3-6,8H2,1-2H3,(H,12,14) |
| InChIKey | CLVGBXMFNKYHGI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|