C10H21NO3 — CID 114756082
2-[1-[(2,2-dimethoxyethylamino)methyl]cyclopropyl]ethanol (PubChem CID 114756082) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-[1-[(2,2-dimethoxyethylamino)methyl]cyclopropyl]ethanol.
| Compound Name | 2-[1-[(2,2-dimethoxyethylamino)methyl]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 114756082 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2-[1-[(2,2-dimethoxyethylamino)methyl]cyclopropyl]ethanol |
| SMILES | COC(CNCC1(CCO)CC1)OC |
| InChI | InChI=1S/C10H21NO3/c1-13-9(14-2)7-11-8-10(3-4-10)5-6-12/h9,11-12H,3-8H2,1-2H3 |
| InChIKey | UZAASUZRQPONAM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|