C11H23NO3 — CID 115454682
[1-[(2,2-diethoxyethylamino)methyl]cyclopropyl]methanol (PubChem CID 115454682) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is [1-[(2,2-diethoxyethylamino)methyl]cyclopropyl]methanol.
| Compound Name | [1-[(2,2-diethoxyethylamino)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 115454682 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | [1-[(2,2-diethoxyethylamino)methyl]cyclopropyl]methanol |
| SMILES | CCOC(CNCC1(CO)CC1)OCC |
| InChI | InChI=1S/C11H23NO3/c1-3-14-10(15-4-2)7-12-8-11(9-13)5-6-11/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | FGPQKZXGRYVMGO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|