C22H28O8 — CID 11475647
[(3R,4S,8R,9S,11R)-2-(ethoxymethyl)-3-hydroxy-11-methyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-1(13)-en-9-yl] (Z)-2-methylbut-2-enoate (PubChem CID 11475647) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is [(3R,4S,8R,9S,11R)-2-(ethoxymethyl)-3-hydroxy-11-methyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-1(13)-en-9-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3R,4S,8R,9S,11R)-2-(ethoxymethyl)-3-hydroxy-11-methyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-1(13)-en-9-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 11475647 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(3R,4S,8R,9S,11R)-2-(ethoxymethyl)-3-hydroxy-11-methyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-1(13)-en-9-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(=O)/C(C)=C\C)C[C@@]1(C)OC(=CC1=O)C(COCC)[C@H]2O |
| InChI | InChI=1S/C22H28O8/c1-6-11(3)20(25)28-15-9-22(5)16(23)8-14(30-22)13(10-27-7-2)18(24)19-17(15)12(4)21(26)29-19/h6,8,13,15,17-19,24H,4,7,9-10H2,1-3,5H3/b11-6-/t13?,15-,17+,18+,19-,22+/m0/s1 |
| InChIKey | GTGBMQIPGILFLF-UHJFKTSSSA-N |
| XLogP | 1.62 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|