C10H15ClN2S — CID 114757524
N-[[1-(2-chloroethyl)cyclopropyl]methyl]-1-(1,3-thiazol-2-yl)methanamine (PubChem CID 114757524) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is N-[[1-(2-chloroethyl)cyclopropyl]methyl]-1-(1,3-thiazol-2-yl)methanamine.
| Compound Name | N-[[1-(2-chloroethyl)cyclopropyl]methyl]-1-(1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 114757524 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | N-[[1-(2-chloroethyl)cyclopropyl]methyl]-1-(1,3-thiazol-2-yl)methanamine |
| SMILES | ClCCC1(CNCc2nccs2)CC1 |
| InChI | InChI=1S/C10H15ClN2S/c11-4-3-10(1-2-10)8-12-7-9-13-5-6-14-9/h5-6,12H,1-4,7-8H2 |
| InChIKey | DAVIEQANTIVTJV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|