C10H13Cl2N3 — CID 114757745
5-chloro-N-[[1-(2-chloroethyl)cyclopropyl]methyl]pyrimidin-2-amine (PubChem CID 114757745) has the molecular formula C10H13Cl2N3 and a molecular weight of 246.14 g/mol. Its IUPAC name is 5-chloro-N-[[1-(2-chloroethyl)cyclopropyl]methyl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[[1-(2-chloroethyl)cyclopropyl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 114757745 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 5-chloro-N-[[1-(2-chloroethyl)cyclopropyl]methyl]pyrimidin-2-amine |
| SMILES | ClCCC1(CNc2ncc(Cl)cn2)CC1 |
| InChI | InChI=1S/C10H13Cl2N3/c11-4-3-10(1-2-10)7-15-9-13-5-8(12)6-14-9/h5-6H,1-4,7H2,(H,13,14,15) |
| InChIKey | OPISVOFPXFCDCX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|