C14H23ClN4 — CID 141172092
5-chloro-N-[3-(4-ethylpiperidin-4-yl)propyl]pyrimidin-2-amine (PubChem CID 141172092) has the molecular formula C14H23ClN4 and a molecular weight of 282.82 g/mol. Its IUPAC name is 5-chloro-N-[3-(4-ethylpiperidin-4-yl)propyl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[3-(4-ethylpiperidin-4-yl)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141172092 |
| Molecular Formula | C14H23ClN4 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 5-chloro-N-[3-(4-ethylpiperidin-4-yl)propyl]pyrimidin-2-amine |
| SMILES | CCC1(CCCNc2ncc(Cl)cn2)CCNCC1 |
| InChI | InChI=1S/C14H23ClN4/c1-2-14(5-8-16-9-6-14)4-3-7-17-13-18-10-12(15)11-19-13/h10-11,16H,2-9H2,1H3,(H,17,18,19) |
| InChIKey | YPHFBBQVNUTNOW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|