C21H29ClN4 — CID 141172126
5-chloro-N-[3-(4-ethyl-1-methylpiperidin-4-yl)propyl]-4-phenylpyrimidin-2-amine (PubChem CID 141172126) has the molecular formula C21H29ClN4 and a molecular weight of 372.94 g/mol. Its IUPAC name is 5-chloro-N-[3-(4-ethyl-1-methylpiperidin-4-yl)propyl]-4-phenylpyrimidin-2-amine.
| Compound Name | 5-chloro-N-[3-(4-ethyl-1-methylpiperidin-4-yl)propyl]-4-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 141172126 |
| Molecular Formula | C21H29ClN4 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 5-chloro-N-[3-(4-ethyl-1-methylpiperidin-4-yl)propyl]-4-phenylpyrimidin-2-amine |
| SMILES | CCC1(CCCNc2ncc(Cl)c(-c3ccccc3)n2)CCN(C)CC1 |
| InChI | InChI=1S/C21H29ClN4/c1-3-21(11-14-26(2)15-12-21)10-7-13-23-20-24-16-18(22)19(25-20)17-8-5-4-6-9-17/h4-6,8-9,16H,3,7,10-15H2,1-2H3,(H,23,24,25) |
| InChIKey | XMXLTWWVXZAZQC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|