C21H27ClN6S — CID 68856127
4-[6-(aminomethyl)-1-benzothiophen-2-yl]-5-chloro-N-[3-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine (PubChem CID 68856127) has the molecular formula C21H27ClN6S and a molecular weight of 431.01 g/mol. Its IUPAC name is 4-[6-(aminomethyl)-1-benzothiophen-2-yl]-5-chloro-N-[3-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine.
| Compound Name | 4-[6-(aminomethyl)-1-benzothiophen-2-yl]-5-chloro-N-[3-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68856127 |
| Molecular Formula | C21H27ClN6S |
| Molecular Weight | 431.01 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-[6-(aminomethyl)-1-benzothiophen-2-yl]-5-chloro-N-[3-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine |
| SMILES | CN1CCN(CCCNc2ncc(Cl)c(-c3cc4ccc(CN)cc4s3)n2)CC1 |
| InChI | InChI=1S/C21H27ClN6S/c1-27-7-9-28(10-8-27)6-2-5-24-21-25-14-17(22)20(26-21)19-12-16-4-3-15(13-23)11-18(16)29-19/h3-4,11-12,14H,2,5-10,13,23H2,1H3,(H,24,25,26) |
| InChIKey | ORVKQCGPESOXOL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.01 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|