C20H25ClN6O2S2 — CID 68857527
2-[5-chloro-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-4-yl]-1-benzothiophene-6-sulfonamide (PubChem CID 68857527) has the molecular formula C20H25ClN6O2S2 and a molecular weight of 481.05 g/mol. Its IUPAC name is 2-[5-chloro-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-4-yl]-1-benzothiophene-6-sulfonamide.
| Compound Name | 2-[5-chloro-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-4-yl]-1-benzothiophene-6-sulfonamide |
|---|---|
| PubChem CID | 68857527 |
| Molecular Formula | C20H25ClN6O2S2 |
| Molecular Weight | 481.05 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 2-[5-chloro-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-4-yl]-1-benzothiophene-6-sulfonamide |
| SMILES | CN1CCN(CCCNc2ncc(Cl)c(-c3cc4ccc(S(N)(=O)=O)cc4s3)n2)CC1 |
| InChI | InChI=1S/C20H25ClN6O2S2/c1-26-7-9-27(10-8-26)6-2-5-23-20-24-13-16(21)19(25-20)18-11-14-3-4-15(31(22,28)29)12-17(14)30-18/h3-4,11-13H,2,5-10H2,1H3,(H2,22,28,29)(H,23,24,25) |
| InChIKey | RYVXLQATUCSZGI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.05 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|