C18H13ClFN5O2S2 — CID 141471201
N-[5-(2-amino-4-methylthieno[2,3-d]pyrimidin-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 141471201) has the molecular formula C18H13ClFN5O2S2 and a molecular weight of 449.92 g/mol. Its IUPAC name is N-[5-(2-amino-4-methylthieno[2,3-d]pyrimidin-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[5-(2-amino-4-methylthieno[2,3-d]pyrimidin-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 141471201 |
| Molecular Formula | C18H13ClFN5O2S2 |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | N-[5-(2-amino-4-methylthieno[2,3-d]pyrimidin-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | Cc1nc(N)nc2sc(-c3cnc(Cl)c(NS(=O)(=O)c4ccc(F)cc4)c3)cc12 |
| InChI | InChI=1S/C18H13ClFN5O2S2/c1-9-13-7-15(28-17(13)24-18(21)23-9)10-6-14(16(19)22-8-10)25-29(26,27)12-4-2-11(20)3-5-12/h2-8,25H,1H3,(H2,21,23,24) |
| InChIKey | UBCWTPNRACWDAI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|