C17H13N5S — CID 45274324
6-benzyl-2-pyrazin-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 45274324) has the molecular formula C17H13N5S and a molecular weight of 319.39 g/mol. Its IUPAC name is 6-benzyl-2-pyrazin-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-benzyl-2-pyrazin-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 45274324 |
| Molecular Formula | C17H13N5S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-benzyl-2-pyrazin-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2cnccn2)nc2sc(Cc3ccccc3)cc12 |
| InChI | InChI=1S/C17H13N5S/c18-15-13-9-12(8-11-4-2-1-3-5-11)23-17(13)22-16(21-15)14-10-19-6-7-20-14/h1-7,9-10H,8H2,(H2,18,21,22) |
| InChIKey | WOPLPHFZOGXYJK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |