C18H19N3S — CID 2100018
4-(4-benzylpiperidin-1-yl)thieno[2,3-d]pyrimidine (PubChem CID 2100018) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-(4-benzylpiperidin-1-yl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 2100018 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)thieno[2,3-d]pyrimidine |
| SMILES | c1ccc(CC2CCN(c3ncnc4sccc34)CC2)cc1 |
| InChI | InChI=1S/C18H19N3S/c1-2-4-14(5-3-1)12-15-6-9-21(10-7-15)17-16-8-11-22-18(16)20-13-19-17/h1-5,8,11,13,15H,6-7,9-10,12H2 |
| InChIKey | AJQCKNBBHOVJGO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |