C20H23ClN6OS — CID 68854644
2-[5-chloro-2-(3-piperazin-1-ylpropylamino)pyrimidin-4-yl]-1-benzothiophene-4-carboxamide (PubChem CID 68854644) has the molecular formula C20H23ClN6OS and a molecular weight of 430.97 g/mol. Its IUPAC name is 2-[5-chloro-2-(3-piperazin-1-ylpropylamino)pyrimidin-4-yl]-1-benzothiophene-4-carboxamide.
| Compound Name | 2-[5-chloro-2-(3-piperazin-1-ylpropylamino)pyrimidin-4-yl]-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 68854644 |
| Molecular Formula | C20H23ClN6OS |
| Molecular Weight | 430.97 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-[5-chloro-2-(3-piperazin-1-ylpropylamino)pyrimidin-4-yl]-1-benzothiophene-4-carboxamide |
| SMILES | NC(=O)c1cccc2sc(-c3nc(NCCCN4CCNCC4)ncc3Cl)cc12 |
| InChI | InChI=1S/C20H23ClN6OS/c21-15-12-25-20(24-5-2-8-27-9-6-23-7-10-27)26-18(15)17-11-14-13(19(22)28)3-1-4-16(14)29-17/h1,3-4,11-12,23H,2,5-10H2,(H2,22,28)(H,24,25,26) |
| InChIKey | GCXNFUXPIOVYLH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.97 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|