C23H27FN6OS — CID 68904076
N-cyclopropyl-2-[5-fluoro-2-(3-piperazin-1-ylpropylamino)pyrimidin-4-yl]-1-benzothiophene-4-carboxamide (PubChem CID 68904076) has the molecular formula C23H27FN6OS and a molecular weight of 454.58 g/mol. Its IUPAC name is N-cyclopropyl-2-[5-fluoro-2-(3-piperazin-1-ylpropylamino)pyrimidin-4-yl]-1-benzothiophene-4-carboxamide.
| Compound Name | N-cyclopropyl-2-[5-fluoro-2-(3-piperazin-1-ylpropylamino)pyrimidin-4-yl]-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 68904076 |
| Molecular Formula | C23H27FN6OS |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-cyclopropyl-2-[5-fluoro-2-(3-piperazin-1-ylpropylamino)pyrimidin-4-yl]-1-benzothiophene-4-carboxamide |
| SMILES | O=C(NC1CC1)c1cccc2sc(-c3nc(NCCCN4CCNCC4)ncc3F)cc12 |
| InChI | InChI=1S/C23H27FN6OS/c24-18-14-27-23(26-7-2-10-30-11-8-25-9-12-30)29-21(18)20-13-17-16(3-1-4-19(17)32-20)22(31)28-15-5-6-15/h1,3-4,13-15,25H,2,5-12H2,(H,28,31)(H,26,27,29) |
| InChIKey | PJPXRKOYCZBPQQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|