C24H28BrN5OS — CID 68857713
2-[5-bromo-2-(3-piperidin-4-ylpropylamino)pyrimidin-4-yl]-N-cyclopropyl-1-benzothiophene-4-carboxamide (PubChem CID 68857713) has the molecular formula C24H28BrN5OS and a molecular weight of 514.49 g/mol. Its IUPAC name is 2-[5-bromo-2-(3-piperidin-4-ylpropylamino)pyrimidin-4-yl]-N-cyclopropyl-1-benzothiophene-4-carboxamide.
| Compound Name | 2-[5-bromo-2-(3-piperidin-4-ylpropylamino)pyrimidin-4-yl]-N-cyclopropyl-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 68857713 |
| Molecular Formula | C24H28BrN5OS |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 2-[5-bromo-2-(3-piperidin-4-ylpropylamino)pyrimidin-4-yl]-N-cyclopropyl-1-benzothiophene-4-carboxamide |
| SMILES | O=C(NC1CC1)c1cccc2sc(-c3nc(NCCCC4CCNCC4)ncc3Br)cc12 |
| InChI | InChI=1S/C24H28BrN5OS/c25-19-14-28-24(27-10-2-3-15-8-11-26-12-9-15)30-22(19)21-13-18-17(4-1-5-20(18)32-21)23(31)29-16-6-7-16/h1,4-5,13-16,26H,2-3,6-12H2,(H,29,31)(H,27,28,30) |
| InChIKey | RYDQXVBDDFMMNB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|