C22H26N4O2S — CID 141172076
2-[2-[3-(1-methylpiperidin-4-yl)propylamino]pyrimidin-4-yl]-1-benzothiophene-4-carboxylic acid (PubChem CID 141172076) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[2-[3-(1-methylpiperidin-4-yl)propylamino]pyrimidin-4-yl]-1-benzothiophene-4-carboxylic acid.
| Compound Name | 2-[2-[3-(1-methylpiperidin-4-yl)propylamino]pyrimidin-4-yl]-1-benzothiophene-4-carboxylic acid |
|---|---|
| PubChem CID | 141172076 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[2-[3-(1-methylpiperidin-4-yl)propylamino]pyrimidin-4-yl]-1-benzothiophene-4-carboxylic acid |
| SMILES | CN1CCC(CCCNc2nccc(-c3cc4c(C(=O)O)cccc4s3)n2)CC1 |
| InChI | InChI=1S/C22H26N4O2S/c1-26-12-8-15(9-13-26)4-3-10-23-22-24-11-7-18(25-22)20-14-17-16(21(27)28)5-2-6-19(17)29-20/h2,5-7,11,14-15H,3-4,8-10,12-13H2,1H3,(H,27,28)(H,23,24,25) |
| InChIKey | RPMQWFLDYFYOLL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|