C22H27ClN6OS — CID 68856124
2-[5-chloro-2-[3-[(2R)-2-methylpiperazin-1-yl]propylamino]pyrimidin-4-yl]-N-methyl-1-benzothiophene-4-carboxamide (PubChem CID 68856124) has the molecular formula C22H27ClN6OS and a molecular weight of 459.02 g/mol. Its IUPAC name is 2-[5-chloro-2-[3-[(2R)-2-methylpiperazin-1-yl]propylamino]pyrimidin-4-yl]-N-methyl-1-benzothiophene-4-carboxamide.
| Compound Name | 2-[5-chloro-2-[3-[(2R)-2-methylpiperazin-1-yl]propylamino]pyrimidin-4-yl]-N-methyl-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 68856124 |
| Molecular Formula | C22H27ClN6OS |
| Molecular Weight | 459.02 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[5-chloro-2-[3-[(2R)-2-methylpiperazin-1-yl]propylamino]pyrimidin-4-yl]-N-methyl-1-benzothiophene-4-carboxamide |
| SMILES | CNC(=O)c1cccc2sc(-c3nc(NCCCN4CCNC[C@H]4C)ncc3Cl)cc12 |
| InChI | InChI=1S/C22H27ClN6OS/c1-14-12-25-8-10-29(14)9-4-7-26-22-27-13-17(23)20(28-22)19-11-16-15(21(30)24-2)5-3-6-18(16)31-19/h3,5-6,11,13-14,25H,4,7-10,12H2,1-2H3,(H,24,30)(H,26,27,28)/t14-/m1/s1 |
| InChIKey | KGUNSXVWZTYNES-CQSZACIVSA-N |
| XLogP | 3.47 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.02 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|