C24H29ClN6OS — CID 68855957
2-[5-chloro-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-4-yl]-N-cyclopropyl-1-benzothiophene-6-carboxamide (PubChem CID 68855957) has the molecular formula C24H29ClN6OS and a molecular weight of 485.06 g/mol. Its IUPAC name is 2-[5-chloro-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-4-yl]-N-cyclopropyl-1-benzothiophene-6-carboxamide.
| Compound Name | 2-[5-chloro-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-4-yl]-N-cyclopropyl-1-benzothiophene-6-carboxamide |
|---|---|
| PubChem CID | 68855957 |
| Molecular Formula | C24H29ClN6OS |
| Molecular Weight | 485.06 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-[5-chloro-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-4-yl]-N-cyclopropyl-1-benzothiophene-6-carboxamide |
| SMILES | CN1CCN(CCCNc2ncc(Cl)c(-c3cc4ccc(C(=O)NC5CC5)cc4s3)n2)CC1 |
| InChI | InChI=1S/C24H29ClN6OS/c1-30-9-11-31(12-10-30)8-2-7-26-24-27-15-19(25)22(29-24)21-13-16-3-4-17(14-20(16)33-21)23(32)28-18-5-6-18/h3-4,13-15,18H,2,5-12H2,1H3,(H,28,32)(H,26,27,29) |
| InChIKey | AAWJCVXFJHFNCY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.06 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|