C20H25ClN6S — CID 68855997
4-(6-amino-1-benzothiophen-2-yl)-5-chloro-N-[3-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine (PubChem CID 68855997) has the molecular formula C20H25ClN6S and a molecular weight of 416.98 g/mol. Its IUPAC name is 4-(6-amino-1-benzothiophen-2-yl)-5-chloro-N-[3-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine.
| Compound Name | 4-(6-amino-1-benzothiophen-2-yl)-5-chloro-N-[3-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68855997 |
| Molecular Formula | C20H25ClN6S |
| Molecular Weight | 416.98 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-(6-amino-1-benzothiophen-2-yl)-5-chloro-N-[3-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine |
| SMILES | CN1CCN(CCCNc2ncc(Cl)c(-c3cc4ccc(N)cc4s3)n2)CC1 |
| InChI | InChI=1S/C20H25ClN6S/c1-26-7-9-27(10-8-26)6-2-5-23-20-24-13-16(21)19(25-20)18-11-14-3-4-15(22)12-17(14)28-18/h3-4,11-13H,2,5-10,22H2,1H3,(H,23,24,25) |
| InChIKey | JBQJAXUBMWYQOC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.98 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|