C19H22ClN5S — CID 68856323
4-(1-benzothiophen-2-yl)-5-chloro-N-(3-piperazin-1-ylpropyl)pyrimidin-2-amine (PubChem CID 68856323) has the molecular formula C19H22ClN5S and a molecular weight of 387.94 g/mol. Its IUPAC name is 4-(1-benzothiophen-2-yl)-5-chloro-N-(3-piperazin-1-ylpropyl)pyrimidin-2-amine.
| Compound Name | 4-(1-benzothiophen-2-yl)-5-chloro-N-(3-piperazin-1-ylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 68856323 |
| Molecular Formula | C19H22ClN5S |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-(1-benzothiophen-2-yl)-5-chloro-N-(3-piperazin-1-ylpropyl)pyrimidin-2-amine |
| SMILES | Clc1cnc(NCCCN2CCNCC2)nc1-c1cc2ccccc2s1 |
| InChI | InChI=1S/C19H22ClN5S/c20-15-13-23-19(22-6-3-9-25-10-7-21-8-11-25)24-18(15)17-12-14-4-1-2-5-16(14)26-17/h1-2,4-5,12-13,21H,3,6-11H2,(H,22,23,24) |
| InChIKey | GNFFGLAINICTET-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|