C15H18BrNOS — CID 114758545
N-[[1-(2-bromoethyl)cyclopropyl]methyl]-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 114758545) has the molecular formula C15H18BrNOS and a molecular weight of 340.29 g/mol. Its IUPAC name is N-[[1-(2-bromoethyl)cyclopropyl]methyl]-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[1-(2-bromoethyl)cyclopropyl]methyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114758545 |
| Molecular Formula | C15H18BrNOS |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-[[1-(2-bromoethyl)cyclopropyl]methyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC1(CCBr)CC1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H18BrNOS/c16-8-7-15(5-6-15)10-17-14(18)13-9-11-3-1-2-4-12(11)19-13/h1-4,13H,5-10H2,(H,17,18) |
| InChIKey | ZQEWSBNTHNZQMZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|