C8H9F2NO2 — CID 114764343
2-amino-3-(2,2-difluoroethoxy)phenol (PubChem CID 114764343) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is 2-amino-3-(2,2-difluoroethoxy)phenol.
| Compound Name | 2-amino-3-(2,2-difluoroethoxy)phenol |
|---|---|
| PubChem CID | 114764343 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-amino-3-(2,2-difluoroethoxy)phenol |
| SMILES | Nc1c(O)cccc1OCC(F)F |
| InChI | InChI=1S/C8H9F2NO2/c9-7(10)4-13-6-3-1-2-5(12)8(6)11/h1-3,7,12H,4,11H2 |
| InChIKey | CCBFDEXKGIOLCD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|