C14H21N3O3 — CID 114765426
6-[(4-carbamoyl-6-methyl-2-pyridinyl)amino]-4-methylhexanoic acid (PubChem CID 114765426) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 6-[(4-carbamoyl-6-methyl-2-pyridinyl)amino]-4-methylhexanoic acid.
| Compound Name | 6-[(4-carbamoyl-6-methyl-2-pyridinyl)amino]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 114765426 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 6-[(4-carbamoyl-6-methyl-2-pyridinyl)amino]-4-methylhexanoic acid |
| SMILES | Cc1cc(C(N)=O)cc(NCCC(C)CCC(=O)O)n1 |
| InChI | InChI=1S/C14H21N3O3/c1-9(3-4-13(18)19)5-6-16-12-8-11(14(15)20)7-10(2)17-12/h7-9H,3-6H2,1-2H3,(H2,15,20)(H,16,17)(H,18,19) |
| InChIKey | UFADTBVOPONXMJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |